![What is the value of sin(10)cos(20)sin(30)cos(40)sin(50)cos(60)sin(70)cos(80)? Not in radians, in degrees. | Socratic What is the value of sin(10)cos(20)sin(30)cos(40)sin(50)cos(60)sin(70)cos(80)? Not in radians, in degrees. | Socratic](https://useruploads.socratic.org/IK25ycsASbety18tGT8x_New%20Doc%202018-01-06_1.jpg)
What is the value of sin(10)cos(20)sin(30)cos(40)sin(50)cos(60)sin(70)cos(80)? Not in radians, in degrees. | Socratic
Prove that (i) cos 20° cos 40° cos 80° = 1/8 (ii) tan 20° tan 40° tan 80° = √3. - Sarthaks eConnect | Largest Online Education Community
![Prove that: (cos20°- sin20°)/(cos20° +sin20°} = tan25°| Trigonometric Ratios of Compound Angles | SciPiPupil Prove that: (cos20°- sin20°)/(cos20° +sin20°} = tan25°| Trigonometric Ratios of Compound Angles | SciPiPupil](https://1.bp.blogspot.com/-6V7OAu94K-g/XqmgTRpVbmI/AAAAAAAAJRQ/rYHbAxIRlV8Rfa2xNWLixkeV_m8-sFGCQCLcBGAsYHQ/s16000/IMG_20200429_173312.png)
Prove that: (cos20°- sin20°)/(cos20° +sin20°} = tan25°| Trigonometric Ratios of Compound Angles | SciPiPupil
![Prove the following identities, where the angles involved are acute angles for which the expressions are defined.(i) (cosectheta-cottheta)^2 = 1 - costheta/1 + costheta (ii) cosA/1 + sinA + 1 + sinA/cosA = Prove the following identities, where the angles involved are acute angles for which the expressions are defined.(i) (cosectheta-cottheta)^2 = 1 - costheta/1 + costheta (ii) cosA/1 + sinA + 1 + sinA/cosA =](https://d2rrqu68q7r435.cloudfront.net/images/5573131/4b3e9cd3-05ff-46a1-8013-956634f3be8b.jpg)